C23H27NO7 — CID 118646273
(2Z,4E)-5-[(1S)-1-hydroxy-3-[(2-methoxy-4-nitrophenyl)methyl]-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 118646273) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is (2Z,4E)-5-[(1S)-1-hydroxy-3-[(2-methoxy-4-nitrophenyl)methyl]-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[(1S)-1-hydroxy-3-[(2-methoxy-4-nitrophenyl)methyl]-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 118646273 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | (2Z,4E)-5-[(1S)-1-hydroxy-3-[(2-methoxy-4-nitrophenyl)methyl]-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | COc1cc([N+](=O)[O-])ccc1CC1=C(C)[C@](O)(/C=C/C(C)=C\C(=O)O)C(C)(C)CC1=O |
| InChI | InChI=1S/C23H27NO7/c1-14(10-21(26)27)8-9-23(28)15(2)18(19(25)13-22(23,3)4)11-16-6-7-17(24(29)30)12-20(16)31-5/h6-10,12,28H,11,13H2,1-5H3,(H,26,27)/b9-8+,14-10-/t23-/m1/s1 |
| InChIKey | MZOZBBNYAGBPCE-PEXKSDECSA-N |
| XLogP | 3.78 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|