C21H32ClN3O3 — CID 165125962
(3E,4Z)-6-chloro-3-ethylidene-4-methylhepta-4,6-dien-2-imine;methanamine;2-methoxy-4-nitro-1-propylbenzene (PubChem CID 165125962) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is (3E,4Z)-6-chloro-3-ethylidene-4-methylhepta-4,6-dien-2-imine;methanamine;2-methoxy-4-nitro-1-propylbenzene.
| Compound Name | (3E,4Z)-6-chloro-3-ethylidene-4-methylhepta-4,6-dien-2-imine;methanamine;2-methoxy-4-nitro-1-propylbenzene |
|---|---|
| PubChem CID | 165125962 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (3E,4Z)-6-chloro-3-ethylidene-4-methylhepta-4,6-dien-2-imine;methanamine;2-methoxy-4-nitro-1-propylbenzene |
| SMILES | CCCc1ccc([N+](=O)[O-])cc1OC.CN.[H]/N=C(C)/C(=C/C)C(/C)=C\C(=C)Cl |
| InChI | InChI=1S/C10H14ClN.C10H13NO3.CH5N/c1-5-10(9(4)12)7(2)6-8(3)11;1-3-4-8-5-6-9(11(12)13)7-10(8)14-2;1-2/h5-6,12H,3H2,1-2,4H3;5-7H,3-4H2,1-2H3;2H2,1H3/b7-6-,10-5-,12-9+;; |
| InChIKey | HCWQMZHPHPOJLS-QKOMHTIGSA-N |
| XLogP | 5.80 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|