About 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene
2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene (PubChem CID 165125973) has the molecular formula C18H21BrClN3O3
and a molecular weight of 442.74 g/mol. Its IUPAC name is 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene.
Molecular Properties
| Compound Name | 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene |
| PubChem CID | 165125973 |
| Molecular Formula | C18H21BrClN3O3 |
| Molecular Weight | 442.74 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene |
| SMILES | CCCc1ccc([N+](=O)[O-])cc1OC.[H]/N=C(\CBr)c1cnc(Cl)cc1C |
| InChI | InChI=1S/C10H13NO3.C8H8BrClN2/c1-3-4-8-5-6-9(11(12)13)7-10(8)14-2;1-5-2-8(10)12-4-6(5)7(11)3-9/h5-7H,3-4H2,1-2H3;2,4,11H,3H2,1H3/b;11-7+ |
| InChIKey | NKRMYIHFFAONNU-HXMQEFCASA-N |
| XLogP | 5.36 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene?
The IUPAC name of 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene (CID 165125973) is 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene.
What is the SMILES notation for 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene?
The canonical SMILES for 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene is CCCc1ccc([N+](=O)[O-])cc1OC.[H]/N=C(\CBr)c1cnc(Cl)cc1C.
What is the InChIKey of 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene?
The InChIKey is NKRMYIHFFAONNU-HXMQEFCASA-N. The full InChI is InChI=1S/C10H13NO3.C8H8BrClN2/c1-3-4-8-5-6-9(11(12)13)7-10(8)14-2;1-5-2-8(10)12-4-6(5)7(11)3-9/h5-7H,3-4H2,1-2H3;2,4,11H,3H2,1H3/b;11-7+.
What are the key properties of 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene?
2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene has a molecular weight of 442.74 g/mol, XLogP of 5.36, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(6-chloro-4-methyl-3-pyridinyl)ethanimine;2-methoxy-4-nitro-1-propylbenzene is sourced from PubChem (CID 165125973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).