C17H27N4OP — CID 11864755
N-methyl-N-[(N-phenyl-C-pyrrolidin-1-ylcarbonimidoyl)-pyrrolidin-1-ylphosphoryl]methanamine (PubChem CID 11864755) has the molecular formula C17H27N4OP and a molecular weight of 334.40 g/mol. Its IUPAC name is N-methyl-N-[(N-phenyl-C-pyrrolidin-1-ylcarbonimidoyl)-pyrrolidin-1-ylphosphoryl]methanamine.
| Compound Name | N-methyl-N-[(N-phenyl-C-pyrrolidin-1-ylcarbonimidoyl)-pyrrolidin-1-ylphosphoryl]methanamine |
|---|---|
| PubChem CID | 11864755 |
| Molecular Formula | C17H27N4OP |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-methyl-N-[(N-phenyl-C-pyrrolidin-1-ylcarbonimidoyl)-pyrrolidin-1-ylphosphoryl]methanamine |
| SMILES | CN(C)[P@](=O)(/C(=N\c1ccccc1)N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C17H27N4OP/c1-19(2)23(22,21-14-8-9-15-21)17(20-12-6-7-13-20)18-16-10-4-3-5-11-16/h3-5,10-11H,6-9,12-15H2,1-2H3/b18-17-/t23-/m1/s1 |
| InChIKey | FHCNACFDJKNIJX-WTXCJRJRSA-N |
| XLogP | 3.62 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|