C20H46N2P2 — CID 118651289
1,1-bis(2-ditert-butylphosphanylethyl)hydrazine (PubChem CID 118651289) has the molecular formula C20H46N2P2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1,1-bis(2-ditert-butylphosphanylethyl)hydrazine.
| Compound Name | 1,1-bis(2-ditert-butylphosphanylethyl)hydrazine |
|---|---|
| PubChem CID | 118651289 |
| Molecular Formula | C20H46N2P2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.31 |
| IUPAC Name | 1,1-bis(2-ditert-butylphosphanylethyl)hydrazine |
| SMILES | CC(C)(C)P(CCN(N)CCP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H46N2P2/c1-17(2,3)23(18(4,5)6)15-13-22(21)14-16-24(19(7,8)9)20(10,11)12/h13-16,21H2,1-12H3 |
| InChIKey | CMJGCYGJOQRBEK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|