C30H48F16P2 — CID 102074563
ditert-butyl-(14-ditert-butylphosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl)phosphane (PubChem CID 102074563) has the molecular formula C30H48F16P2 and a molecular weight of 774.63 g/mol. Its IUPAC name is ditert-butyl-(14-ditert-butylphosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl)phosphane.
| Compound Name | ditert-butyl-(14-ditert-butylphosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl)phosphane |
|---|---|
| PubChem CID | 102074563 |
| Molecular Formula | C30H48F16P2 |
| Molecular Weight | 774.63 g/mol |
| Exact Mass | 774.30 |
| IUPAC Name | ditert-butyl-(14-ditert-butylphosphanyl-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluorotetradecyl)phosphane |
| SMILES | CC(C)(C)P(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCP(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C30H48F16P2/c1-19(2,3)47(20(4,5)6)17-13-15-23(31,32)25(35,36)27(39,40)29(43,44)30(45,46)28(41,42)26(37,38)24(33,34)16-14-18-48(21(7,8)9)22(10,11)12/h13-18H2,1-12H3 |
| InChIKey | MWRFAZXRAZSKCM-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.63 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|