C19H36S2 — CID 118652296
(6E,8E)-1-(3-methylbutyldisulfanyl)tetradeca-6,8-diene (PubChem CID 118652296) has the molecular formula C19H36S2 and a molecular weight of 328.63 g/mol. Its IUPAC name is (6E,8E)-1-(3-methylbutyldisulfanyl)tetradeca-6,8-diene.
| Compound Name | (6E,8E)-1-(3-methylbutyldisulfanyl)tetradeca-6,8-diene |
|---|---|
| PubChem CID | 118652296 |
| Molecular Formula | C19H36S2 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (6E,8E)-1-(3-methylbutyldisulfanyl)tetradeca-6,8-diene |
| SMILES | CCCCC/C=C/C=C/CCCCCSSCCC(C)C |
| InChI | InChI=1S/C19H36S2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17-20-21-18-16-19(2)3/h8-11,19H,4-7,12-18H2,1-3H3/b9-8+,11-10+ |
| InChIKey | IVIGMYWGMZBNNK-BNFZFUHLSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|