C38H39FO6S — CID 118654782
methyl 3-[4-[[13-[(1,1-dioxothian-4-yl)oxymethyl]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-3-(4-fluorophenyl)propanoate (PubChem CID 118654782) has the molecular formula C38H39FO6S and a molecular weight of 642.79 g/mol. Its IUPAC name is methyl 3-[4-[[13-[(1,1-dioxothian-4-yl)oxymethyl]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-3-(4-fluorophenyl)propanoate.
| Compound Name | methyl 3-[4-[[13-[(1,1-dioxothian-4-yl)oxymethyl]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 118654782 |
| Molecular Formula | C38H39FO6S |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | methyl 3-[4-[[13-[(1,1-dioxothian-4-yl)oxymethyl]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-3-(4-fluorophenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(F)cc1)c1ccc(OCc2ccc3c(c2)-c2ccc(COC4CCS(=O)(=O)CC4)cc2CCC3)cc1 |
| InChI | InChI=1S/C38H39FO6S/c1-43-38(40)23-36(29-8-12-32(39)13-9-29)30-10-14-33(15-11-30)44-25-27-5-7-28-3-2-4-31-21-26(6-16-35(31)37(28)22-27)24-45-34-17-19-46(41,42)20-18-34/h5-16,21-22,34,36H,2-4,17-20,23-25H2,1H3 |
| InChIKey | SPRMPYMELDLIMY-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |