C32H25NO4 — CID 118655372
3-tert-butyl-7-[4-(N-phenylanilino)phenyl]furo[2,3-f][1]benzofuran-2,6-dione (PubChem CID 118655372) has the molecular formula C32H25NO4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-tert-butyl-7-[4-(N-phenylanilino)phenyl]furo[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3-tert-butyl-7-[4-(N-phenylanilino)phenyl]furo[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 118655372 |
| Molecular Formula | C32H25NO4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 3-tert-butyl-7-[4-(N-phenylanilino)phenyl]furo[2,3-f][1]benzofuran-2,6-dione |
| SMILES | CC(C)(C)C1=c2cc3c(cc2OC1=O)=C(c1ccc(N(c2ccccc2)c2ccccc2)cc1)C(=O)O3 |
| InChI | InChI=1S/C32H25NO4/c1-32(2,3)29-25-19-26-24(18-27(25)37-31(29)35)28(30(34)36-26)20-14-16-23(17-15-20)33(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-19H,1-3H3 |
| InChIKey | VTHVHASBXNEUCA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|