C36H25NO4 — CID 118655370
3-[4-(2-methyl-N-(2-methylphenyl)anilino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione (PubChem CID 118655370) has the molecular formula C36H25NO4 and a molecular weight of 535.60 g/mol. Its IUPAC name is 3-[4-(2-methyl-N-(2-methylphenyl)anilino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3-[4-(2-methyl-N-(2-methylphenyl)anilino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 118655370 |
| Molecular Formula | C36H25NO4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3-[4-(2-methyl-N-(2-methylphenyl)anilino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
| SMILES | Cc1ccccc1N(c1ccc(C2=c3cc4c(cc3OC2=O)=C(c2ccccc2)C(=O)O4)cc1)c1ccccc1C |
| InChI | InChI=1S/C36H25NO4/c1-22-10-6-8-14-29(22)37(30-15-9-7-11-23(30)2)26-18-16-25(17-19-26)34-28-21-31-27(20-32(28)41-36(34)39)33(35(38)40-31)24-12-4-3-5-13-24/h3-21H,1-2H3 |
| InChIKey | YGWPYMOYOGUEBR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|