C28H25NO4 — CID 54199112
3-[3-butyl-4-(ethylamino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione (PubChem CID 54199112) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is 3-[3-butyl-4-(ethylamino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3-[3-butyl-4-(ethylamino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 54199112 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 3-[3-butyl-4-(ethylamino)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
| SMILES | CCCCc1cc(C2=c3cc4c(cc3OC2=O)=C(c2ccccc2)C(=O)O4)ccc1NCC |
| InChI | InChI=1S/C28H25NO4/c1-3-5-9-18-14-19(12-13-22(18)29-4-2)26-21-16-23-20(15-24(21)33-28(26)31)25(27(30)32-23)17-10-7-6-8-11-17/h6-8,10-16,29H,3-5,9H2,1-2H3 |
| InChIKey | PNYRZDDYOWUYQC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|