C22H12O4 — CID 86004685
3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione (PubChem CID 86004685) has the molecular formula C22H12O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione.
| Compound Name | 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione |
|---|---|
| PubChem CID | 86004685 |
| Molecular Formula | C22H12O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione |
| SMILES | O=C1Oc2c3c(ccc2=C1c1ccccc1)=C(c1ccccc1)C(=O)O3 |
| InChI | InChI=1S/C22H12O4/c23-21-17(13-7-3-1-4-8-13)15-11-12-16-18(14-9-5-2-6-10-14)22(24)26-20(16)19(15)25-21/h1-12H |
| InChIKey | AXCXUBGUABXPJO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|