About 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione
3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione (PubChem CID 86004685) has the molecular formula C22H12O4
and a molecular weight of 340.33 g/mol. Its IUPAC name is 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione.
Molecular Properties
| Compound Name | 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione |
| PubChem CID | 86004685 |
| Molecular Formula | C22H12O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione |
| SMILES | O=C1Oc2c3c(ccc2=C1c1ccccc1)=C(c1ccccc1)C(=O)O3 |
| InChI | InChI=1S/C22H12O4/c23-21-17(13-7-3-1-4-8-13)15-11-12-16-18(14-9-5-2-6-10-14)22(24)26-20(16)19(15)25-21/h1-12H |
| InChIKey | AXCXUBGUABXPJO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione?
The IUPAC name of 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione (CID 86004685) is 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione.
What is the SMILES notation for 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione?
The canonical SMILES for 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione is O=C1Oc2c3c(ccc2=C1c1ccccc1)=C(c1ccccc1)C(=O)O3.
What is the InChIKey of 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione?
The InChIKey is AXCXUBGUABXPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12O4/c23-21-17(13-7-3-1-4-8-13)15-11-12-16-18(14-9-5-2-6-10-14)22(24)26-20(16)19(15)25-21/h1-12H.
What are the key properties of 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione?
3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione has a molecular weight of 340.33 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diphenylfuro[3,2-g][1]benzofuran-2,7-dione is sourced from PubChem (CID 86004685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).