C28H16O5 — CID 148598545
3-(4-hydroxyphenyl)-7-(4-phenylphenyl)furo[2,3-f][1]benzofuran-2,6-dione (PubChem CID 148598545) has the molecular formula C28H16O5 and a molecular weight of 432.43 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-7-(4-phenylphenyl)furo[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3-(4-hydroxyphenyl)-7-(4-phenylphenyl)furo[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 148598545 |
| Molecular Formula | C28H16O5 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 3-(4-hydroxyphenyl)-7-(4-phenylphenyl)furo[2,3-f][1]benzofuran-2,6-dione |
| SMILES | O=C1Oc2cc3c(cc2=C1c1ccc(O)cc1)OC(=O)C=3c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H16O5/c29-20-12-10-19(11-13-20)26-22-15-23-21(14-24(22)33-28(26)31)25(27(30)32-23)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-15,29H |
| InChIKey | NCBDNAIJXJAJAK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|