C18H12O6 — CID 102217340
(2E)-2-[3-hydroxy-4-(4-hydroxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetic acid (PubChem CID 102217340) has the molecular formula C18H12O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is (2E)-2-[3-hydroxy-4-(4-hydroxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetic acid.
| Compound Name | (2E)-2-[3-hydroxy-4-(4-hydroxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetic acid |
|---|---|
| PubChem CID | 102217340 |
| Molecular Formula | C18H12O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (2E)-2-[3-hydroxy-4-(4-hydroxyphenyl)-5-oxofuran-2-ylidene]-2-phenylacetic acid |
| SMILES | O=C1O/C(=C(/C(=O)O)c2ccccc2)C(O)=C1c1ccc(O)cc1 |
| InChI | InChI=1S/C18H12O6/c19-12-8-6-11(7-9-12)13-15(20)16(24-18(13)23)14(17(21)22)10-4-2-1-3-5-10/h1-9,19-20H,(H,21,22)/b16-14+ |
| InChIKey | AZLZUPINLCKHIS-JQIJEIRASA-N |
| XLogP | 2.71 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|