C29H20O2Se — CID 11145260
(5E)-3,4-diphenyl-5-[phenyl(phenylselanyl)methylidene]furan-2-one (PubChem CID 11145260) has the molecular formula C29H20O2Se and a molecular weight of 479.44 g/mol. Its IUPAC name is (5E)-3,4-diphenyl-5-[phenyl(phenylselanyl)methylidene]furan-2-one.
| Compound Name | (5E)-3,4-diphenyl-5-[phenyl(phenylselanyl)methylidene]furan-2-one |
|---|---|
| PubChem CID | 11145260 |
| Molecular Formula | C29H20O2Se |
| Molecular Weight | 479.44 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | (5E)-3,4-diphenyl-5-[phenyl(phenylselanyl)methylidene]furan-2-one |
| SMILES | O=C1O/C(=C(/[Se]c2ccccc2)c2ccccc2)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C29H20O2Se/c30-29-26(22-15-7-2-8-16-22)25(21-13-5-1-6-14-21)27(31-29)28(23-17-9-3-10-18-23)32-24-19-11-4-12-20-24/h1-20H/b28-27+ |
| InChIKey | KRUFSZVRWCWPML-BYYHNAKLSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|