C27H22O2 — CID 14529383
2-(3,5-dimethyl-2,6-diphenylpyran-4-ylidene)-1-phenylethanone (PubChem CID 14529383) has the molecular formula C27H22O2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-(3,5-dimethyl-2,6-diphenylpyran-4-ylidene)-1-phenylethanone.
| Compound Name | 2-(3,5-dimethyl-2,6-diphenylpyran-4-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 14529383 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-(3,5-dimethyl-2,6-diphenylpyran-4-ylidene)-1-phenylethanone |
| SMILES | CC1=C(c2ccccc2)OC(c2ccccc2)=C(C)C1=CC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22O2/c1-19-24(18-25(28)21-12-6-3-7-13-21)20(2)27(23-16-10-5-11-17-23)29-26(19)22-14-8-4-9-15-22/h3-18H,1-2H3 |
| InChIKey | SXVVBLURKFUXRY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|