C13H12OS2 — CID 619119
2-(4,5-dimethyldithiol-3-ylidene)-1-phenylethanone (PubChem CID 619119) has the molecular formula C13H12OS2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(4,5-dimethyldithiol-3-ylidene)-1-phenylethanone.
| Compound Name | 2-(4,5-dimethyldithiol-3-ylidene)-1-phenylethanone |
|---|---|
| PubChem CID | 619119 |
| Molecular Formula | C13H12OS2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 2-(4,5-dimethyldithiol-3-ylidene)-1-phenylethanone |
| SMILES | CC1=C(C)C(=CC(=O)c2ccccc2)SS1 |
| InChI | InChI=1S/C13H12OS2/c1-9-10(2)15-16-13(9)8-12(14)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | ARXINBNCMWDTHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|