C26H20O6 — CID 14028800
3-[4-(2-ethoxyethoxy)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione (PubChem CID 14028800) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-[4-(2-ethoxyethoxy)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3-[4-(2-ethoxyethoxy)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 14028800 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 3-[4-(2-ethoxyethoxy)phenyl]-7-phenylfuro[2,3-f][1]benzofuran-2,6-dione |
| SMILES | CCOCCOc1ccc(C2=c3cc4c(cc3OC2=O)=C(c2ccccc2)C(=O)O4)cc1 |
| InChI | InChI=1S/C26H20O6/c1-2-29-12-13-30-18-10-8-17(9-11-18)24-20-15-21-19(14-22(20)32-26(24)28)23(25(27)31-21)16-6-4-3-5-7-16/h3-11,14-15H,2,12-13H2,1H3 |
| InChIKey | RVSCVECSTUHLNN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|