C42H36O8S2 — CID 123953289
3,7-bis[4-(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)phenyl]furo[2,3-f][1]benzofuran-2,6-dione (PubChem CID 123953289) has the molecular formula C42H36O8S2 and a molecular weight of 732.88 g/mol. Its IUPAC name is 3,7-bis[4-(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)phenyl]furo[2,3-f][1]benzofuran-2,6-dione.
| Compound Name | 3,7-bis[4-(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)phenyl]furo[2,3-f][1]benzofuran-2,6-dione |
|---|---|
| PubChem CID | 123953289 |
| Molecular Formula | C42H36O8S2 |
| Molecular Weight | 732.88 g/mol |
| Exact Mass | 732.19 |
| IUPAC Name | 3,7-bis[4-(5-tert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)phenyl]furo[2,3-f][1]benzofuran-2,6-dione |
| SMILES | CC(C)(C)c1sc(-c2ccc(C3=c4cc5c(cc4OC3=O)=C(c3ccc(-c4sc(C(C)(C)C)c6c4OCCO6)cc3)C(=O)O5)cc2)c2c1OCCO2 |
| InChI | InChI=1S/C42H36O8S2/c1-41(2,3)37-33-31(45-15-17-47-33)35(51-37)23-11-7-21(8-12-23)29-25-19-28-26(20-27(25)49-39(29)43)30(40(44)50-28)22-9-13-24(14-10-22)36-32-34(48-18-16-46-32)38(52-36)42(4,5)6/h7-14,19-20H,15-18H2,1-6H3 |
| InChIKey | YKFBSWCWBSENDM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|