C17H20O4S2 — CID 134312892
5-tert-butyl-7-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 134312892) has the molecular formula C17H20O4S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 5-tert-butyl-7-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-tert-butyl-7-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 134312892 |
| Molecular Formula | C17H20O4S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-tert-butyl-7-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | Cc1sc(-c2sc(C(C)(C)C)c3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C17H20O4S2/c1-9-10-11(19-6-5-18-10)14(22-9)15-12-13(21-8-7-20-12)16(23-15)17(2,3)4/h5-8H2,1-4H3 |
| InChIKey | BORGSSGIZHVUKG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |