C49H84O6S2 — CID 171579208
3,3-bis(2-hexyldecoxymethyl)-8-methyl-6-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 171579208) has the molecular formula C49H84O6S2 and a molecular weight of 833.34 g/mol. Its IUPAC name is 3,3-bis(2-hexyldecoxymethyl)-8-methyl-6-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-bis(2-hexyldecoxymethyl)-8-methyl-6-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 171579208 |
| Molecular Formula | C49H84O6S2 |
| Molecular Weight | 833.34 g/mol |
| Exact Mass | 832.57 |
| IUPAC Name | 3,3-bis(2-hexyldecoxymethyl)-8-methyl-6-(7-methyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCCCCCCCC(CCCCCC)COCC1(COCC(CCCCCC)CCCCCCCC)COc2c(C)sc(-c3sc(C)c4c3OCCO4)c2OC1 |
| InChI | InChI=1S/C49H84O6S2/c1-7-11-15-19-21-25-29-41(27-23-17-13-9-3)33-50-35-49(36-51-34-42(28-24-18-14-10-4)30-26-22-20-16-12-8-2)37-54-44-40(6)57-48(46(44)55-38-49)47-45-43(39(5)56-47)52-31-32-53-45/h41-42H,7-38H2,1-6H3 |
| InChIKey | JHBCGXMJWOJBJQ-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.34 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|