C49H82O4S3 — CID 163498822
3,3-bis(2-ethylhexoxymethyl)-6-(4-hexyl-5-methylthiophen-2-yl)-8-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine;3-hexyl-2,5-dimethylthiophene (PubChem CID 163498822) has the molecular formula C49H82O4S3 and a molecular weight of 831.39 g/mol. Its IUPAC name is 3,3-bis(2-ethylhexoxymethyl)-6-(4-hexyl-5-methylthiophen-2-yl)-8-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine;3-hexyl-2,5-dimethylthiophene.
| Compound Name | 3,3-bis(2-ethylhexoxymethyl)-6-(4-hexyl-5-methylthiophen-2-yl)-8-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine;3-hexyl-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 163498822 |
| Molecular Formula | C49H82O4S3 |
| Molecular Weight | 831.39 g/mol |
| Exact Mass | 830.54 |
| IUPAC Name | 3,3-bis(2-ethylhexoxymethyl)-6-(4-hexyl-5-methylthiophen-2-yl)-8-methyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine;3-hexyl-2,5-dimethylthiophene |
| SMILES | CCCCCCc1cc(-c2sc(C)c3c2OCC(COCC(CC)CCCC)(COCC(CC)CCCC)CO3)sc1C.CCCCCCc1cc(C)sc1C |
| InChI | InChI=1S/C37H62O4S2.C12H20S/c1-8-13-16-17-20-32-21-33(42-28(32)6)36-35-34(29(7)43-36)40-26-37(27-41-35,24-38-22-30(11-4)18-14-9-2)25-39-23-31(12-5)19-15-10-3;1-4-5-6-7-8-12-9-10(2)13-11(12)3/h21,30-31H,8-20,22-27H2,1-7H3;9H,4-8H2,1-3H3 |
| InChIKey | CSYWEBJWFNPJNW-UHFFFAOYSA-N |
| XLogP | 15.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.39 |
| LogP ≤ 5 | 15.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|