C31H47ClO6S2 — CID 166505307
6-(5-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-3,3-bis(2-ethylhexoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 166505307) has the molecular formula C31H47ClO6S2 and a molecular weight of 615.30 g/mol. Its IUPAC name is 6-(5-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-3,3-bis(2-ethylhexoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 6-(5-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-3,3-bis(2-ethylhexoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 166505307 |
| Molecular Formula | C31H47ClO6S2 |
| Molecular Weight | 615.30 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 6-(5-chloro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-3,3-bis(2-ethylhexoxymethyl)-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCCCC(CC)COCC1(COCC(CC)CCCC)COc2csc(-c3sc(Cl)c4c3OCCO4)c2OC1 |
| InChI | InChI=1S/C31H47ClO6S2/c1-5-9-11-22(7-3)15-33-18-31(19-34-16-23(8-4)12-10-6-2)20-37-24-17-39-28(25(24)38-21-31)29-26-27(30(32)40-29)36-14-13-35-26/h17,22-23H,5-16,18-21H2,1-4H3 |
| InChIKey | NXAGGDGSOGZFEZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.30 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |