C20H18O6S3+ — CID 172526149
CID 172526149 (PubChem CID 172526149) has the molecular formula C20H18O6S3+ and a molecular weight of 450.56 g/mol.
| Compound Name | CID 172526149 |
|---|---|
| PubChem CID | 172526149 |
| Molecular Formula | C20H18O6S3+ |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | — |
| SMILES | CC1=[S+]C(c2sc(-c3sc(C)c4c3OCCO4)c3c2OCCO3)=C2OCCO[C]12 |
| InChI | InChI=1S/C20H18O6S3/c1-9-11-13(23-5-3-21-11)17(27-9)19-15-16(26-8-7-25-15)20(29-19)18-14-12(10(2)28-18)22-4-6-24-14/h3-8H2,1-2H3/q+1 |
| InChIKey | JKTDZWOCJIOSBZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|