C28H34N4O2S3Si2 — CID 102234654
[7-[5-(2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dimethylthieno[3,4-b]pyrazin-5-yl]-trimethylsilane (PubChem CID 102234654) has the molecular formula C28H34N4O2S3Si2 and a molecular weight of 610.98 g/mol. Its IUPAC name is [7-[5-(2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dimethylthieno[3,4-b]pyrazin-5-yl]-trimethylsilane.
| Compound Name | [7-[5-(2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dimethylthieno[3,4-b]pyrazin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102234654 |
| Molecular Formula | C28H34N4O2S3Si2 |
| Molecular Weight | 610.98 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | [7-[5-(2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dimethylthieno[3,4-b]pyrazin-5-yl]-trimethylsilane |
| SMILES | Cc1nc2c(-c3sc(-c4sc([Si](C)(C)C)c5nc(C)c(C)nc45)c4c3OCCO4)sc([Si](C)(C)C)c2nc1C |
| InChI | InChI=1S/C28H34N4O2S3Si2/c1-13-15(3)31-19-17(29-13)23(36-27(19)38(5,6)7)25-21-22(34-12-11-33-21)26(35-25)24-18-20(28(37-24)39(8,9)10)32-16(4)14(2)30-18/h11-12H2,1-10H3 |
| InChIKey | ZIPXJHQGSXXQGQ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.98 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|