C14H24N2SSi2 — CID 132837556
(2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-trimethylsilane (PubChem CID 132837556) has the molecular formula C14H24N2SSi2 and a molecular weight of 308.60 g/mol. Its IUPAC name is (2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-trimethylsilane.
| Compound Name | (2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-trimethylsilane |
|---|---|
| PubChem CID | 132837556 |
| Molecular Formula | C14H24N2SSi2 |
| Molecular Weight | 308.60 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2,3-dimethyl-5-trimethylsilylthieno[3,4-b]pyrazin-7-yl)-trimethylsilane |
| SMILES | Cc1nc2c([Si](C)(C)C)sc([Si](C)(C)C)c2nc1C |
| InChI | InChI=1S/C14H24N2SSi2/c1-9-10(2)16-12-11(15-9)13(18(3,4)5)17-14(12)19(6,7)8/h1-8H3 |
| InChIKey | NDHZOVXTNMIWSG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|