C7H7BO2S — CID 89189760
CID 89189760 (PubChem CID 89189760) has the molecular formula C7H7BO2S and a molecular weight of 166.01 g/mol.
| Compound Name | CID 89189760 |
|---|---|
| PubChem CID | 89189760 |
| Molecular Formula | C7H7BO2S |
| Molecular Weight | 166.01 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | — |
| SMILES | [B]c1sc(C)c2c1OCCO2 |
| InChI | InChI=1S/C7H7BO2S/c1-4-5-6(7(8)11-4)10-3-2-9-5/h2-3H2,1H3 |
| InChIKey | WJOSWHFBZLHDCM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.01 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|