C8H10OS — CID 118028776
4,6-dimethyl-2,3-dihydrothieno[3,4-b]furan (PubChem CID 118028776) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 4,6-dimethyl-2,3-dihydrothieno[3,4-b]furan.
| Compound Name | 4,6-dimethyl-2,3-dihydrothieno[3,4-b]furan |
|---|---|
| PubChem CID | 118028776 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 4,6-dimethyl-2,3-dihydrothieno[3,4-b]furan |
| SMILES | Cc1sc(C)c2c1CCO2 |
| InChI | InChI=1S/C8H10OS/c1-5-7-3-4-9-8(7)6(2)10-5/h3-4H2,1-2H3 |
| InChIKey | ZCJJEWXWVYJYDG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |