C8H11NO — CID 130401378
4,6-dimethyl-3,5-dihydro-2H-furo[2,3-c]pyrrole (PubChem CID 130401378) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 4,6-dimethyl-3,5-dihydro-2H-furo[2,3-c]pyrrole.
| Compound Name | 4,6-dimethyl-3,5-dihydro-2H-furo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 130401378 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 4,6-dimethyl-3,5-dihydro-2H-furo[2,3-c]pyrrole |
| SMILES | Cc1[nH]c(C)c2c1CCO2 |
| InChI | InChI=1S/C8H11NO/c1-5-7-3-4-10-8(7)6(2)9-5/h9H,3-4H2,1-2H3 |
| InChIKey | GAEWDDVRYMWUCQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |