C22H21N5 — CID 118657115
3-[2-(4-pyridin-4-ylpiperidin-1-yl)-4-pyridinyl]-1H-indazole (PubChem CID 118657115) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 3-[2-(4-pyridin-4-ylpiperidin-1-yl)-4-pyridinyl]-1H-indazole.
| Compound Name | 3-[2-(4-pyridin-4-ylpiperidin-1-yl)-4-pyridinyl]-1H-indazole |
|---|---|
| PubChem CID | 118657115 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[2-(4-pyridin-4-ylpiperidin-1-yl)-4-pyridinyl]-1H-indazole |
| SMILES | c1ccc2c(-c3ccnc(N4CCC(c5ccncc5)CC4)c3)n[nH]c2c1 |
| InChI | InChI=1S/C22H21N5/c1-2-4-20-19(3-1)22(26-25-20)18-7-12-24-21(15-18)27-13-8-17(9-14-27)16-5-10-23-11-6-16/h1-7,10-12,15,17H,8-9,13-14H2,(H,25,26) |
| InChIKey | PCBLKIKEJXTLRU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |