C32H54N2O7 — CID 118657453
4-[4-[[(4R)-4-[(10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoylamino]butanoic acid (PubChem CID 118657453) has the molecular formula C32H54N2O7 and a molecular weight of 578.79 g/mol. Its IUPAC name is 4-[4-[[(4R)-4-[(10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoylamino]butanoic acid.
| Compound Name | 4-[4-[[(4R)-4-[(10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoylamino]butanoic acid |
|---|---|
| PubChem CID | 118657453 |
| Molecular Formula | C32H54N2O7 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | 4-[4-[[(4R)-4-[(10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoylamino]butanoic acid |
| SMILES | C[C@H](CCC(=O)NCCCC(=O)NCCCC(=O)O)C1CCC2C3C(O)CC4CC(O)CC[C@]4(C)C3CC(O)[C@@]21C |
| InChI | InChI=1S/C32H54N2O7/c1-19(8-11-28(39)34-14-4-6-27(38)33-15-5-7-29(40)41)22-9-10-23-30-24(18-26(37)32(22,23)3)31(2)13-12-21(35)16-20(31)17-25(30)36/h19-26,30,35-37H,4-18H2,1-3H3,(H,33,38)(H,34,39)(H,40,41)/t19-,20?,21?,22?,23?,24?,25?,26?,30?,31+,32-/m1/s1 |
| InChIKey | JFLIDBLRCWGPLH-OTDWKKNZSA-N |
| XLogP | 3.24 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|