C28H50N2O4 — CID 157383334
N-(4-aminobutyl)-4-[(3R,5S,7S,8R,14S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide (PubChem CID 157383334) has the molecular formula C28H50N2O4 and a molecular weight of 478.72 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-[(3R,5S,7S,8R,14S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide.
| Compound Name | N-(4-aminobutyl)-4-[(3R,5S,7S,8R,14S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
|---|---|
| PubChem CID | 157383334 |
| Molecular Formula | C28H50N2O4 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.38 |
| IUPAC Name | N-(4-aminobutyl)-4-[(3R,5S,7S,8R,14S)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanamide |
| SMILES | CC(CCC(=O)NCCCCN)C1CC[C@H]2[C@H]3C(CC(O)C12C)C1(C)CC[C@@H](O)C[C@H]1C[C@@H]3O |
| InChI | InChI=1S/C28H50N2O4/c1-17(6-9-25(34)30-13-5-4-12-29)20-7-8-21-26-22(16-24(33)28(20,21)3)27(2)11-10-19(31)14-18(27)15-23(26)32/h17-24,26,31-33H,4-16,29H2,1-3H3,(H,30,34)/t17?,18-,19+,20?,21-,22?,23-,24?,26-,27?,28?/m0/s1 |
| InChIKey | SZKVZPPSEIKKIU-YVMOEYLOSA-N |
| XLogP | 3.22 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|