C32H57NO4 — CID 145176549
N-octyl-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide (PubChem CID 145176549) has the molecular formula C32H57NO4 and a molecular weight of 519.81 g/mol. Its IUPAC name is N-octyl-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide.
| Compound Name | N-octyl-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
|---|---|
| PubChem CID | 145176549 |
| Molecular Formula | C32H57NO4 |
| Molecular Weight | 519.81 g/mol |
| Exact Mass | 519.43 |
| IUPAC Name | N-octyl-4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanamide |
| SMILES | CCCCCCCCNC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C32H57NO4/c1-5-6-7-8-9-10-17-33-29(37)14-11-21(2)24-12-13-25-30-26(20-28(36)32(24,25)4)31(3)16-15-23(34)18-22(31)19-27(30)35/h21-28,30,34-36H,5-20H2,1-4H3,(H,33,37) |
| InChIKey | RDPWECLZNGRUOK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.81 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|