C33H61N2O4+ — CID 58196110
butyl-dimethyl-[3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]propyl]azanium (PubChem CID 58196110) has the molecular formula C33H61N2O4+ and a molecular weight of 549.86 g/mol. Its IUPAC name is butyl-dimethyl-[3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]propyl]azanium.
| Compound Name | butyl-dimethyl-[3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]propyl]azanium |
|---|---|
| PubChem CID | 58196110 |
| Molecular Formula | C33H61N2O4+ |
| Molecular Weight | 549.86 g/mol |
| Exact Mass | 549.46 |
| IUPAC Name | butyl-dimethyl-[3-[4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]propyl]azanium |
| SMILES | CCCC[N+](C)(C)CCCNC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C33H60N2O4/c1-7-8-17-35(5,6)18-9-16-34-30(39)13-10-22(2)25-11-12-26-31-27(21-29(38)33(25,26)4)32(3)15-14-24(36)19-23(32)20-28(31)37/h22-29,31,36-38H,7-21H2,1-6H3/p+1 |
| InChIKey | BFVWEKZTOLQSLV-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|