C18H27N3O8S2 — CID 118661230
[(1R,2R,4S)-4-(dimethylcarbamoyl)-2-(phenylmethoxycarbonylsulfamoylamino)cyclohexyl] methanesulfonate (PubChem CID 118661230) has the molecular formula C18H27N3O8S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-(phenylmethoxycarbonylsulfamoylamino)cyclohexyl] methanesulfonate.
| Compound Name | [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-(phenylmethoxycarbonylsulfamoylamino)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 118661230 |
| Molecular Formula | C18H27N3O8S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | [(1R,2R,4S)-4-(dimethylcarbamoyl)-2-(phenylmethoxycarbonylsulfamoylamino)cyclohexyl] methanesulfonate |
| SMILES | CN(C)C(=O)[C@H]1CC[C@@H](OS(C)(=O)=O)[C@H](NS(=O)(=O)NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O8S2/c1-21(2)17(22)14-9-10-16(29-30(3,24)25)15(11-14)19-31(26,27)20-18(23)28-12-13-7-5-4-6-8-13/h4-8,14-16,19H,9-12H2,1-3H3,(H,20,23)/t14-,15+,16+/m0/s1 |
| InChIKey | OQTCMHLMIFSJLO-ARFHVFGLSA-N |
| XLogP | 0.35 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|