C19H29N8O7P — CID 118661634
[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[(3-hexyl-5-methylidene-4H-triazol-4-yl)oxy]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 118661634) has the molecular formula C19H29N8O7P and a molecular weight of 512.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[(3-hexyl-5-methylidene-4H-triazol-4-yl)oxy]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[(3-hexyl-5-methylidene-4H-triazol-4-yl)oxy]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118661634 |
| Molecular Formula | C19H29N8O7P |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-[(3-hexyl-5-methylidene-4H-triazol-4-yl)oxy]-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | C=C1N=NN(CCCCCC)C1O[C@@H]1[C@H](OP(=O)(O)O)[C@@H](CO)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C19H29N8O7P/c1-3-4-5-6-7-27-18(11(2)24-25-27)33-15-14(34-35(29,30)31)12(8-28)32-19(15)26-10-23-13-16(20)21-9-22-17(13)26/h9-10,12,14-15,18-19,28H,2-8H2,1H3,(H2,20,21,22)(H2,29,30,31)/t12-,14-,15-,18?,19-/m1/s1 |
| InChIKey | AJPUUXIVKPVXRE-NPTMZENYSA-N |
| XLogP | 1.26 |
| TPSA | 203.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|