C15H9BrF3N3O2 — CID 118664683
methyl 6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxylate (PubChem CID 118664683) has the molecular formula C15H9BrF3N3O2 and a molecular weight of 400.15 g/mol. Its IUPAC name is methyl 6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxylate.
| Compound Name | methyl 6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxylate |
|---|---|
| PubChem CID | 118664683 |
| Molecular Formula | C15H9BrF3N3O2 |
| Molecular Weight | 400.15 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | methyl 6-bromo-1-[6-(trifluoromethyl)-2-pyridinyl]indazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2c1cnn2-c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C15H9BrF3N3O2/c1-24-14(23)9-5-8(16)6-11-10(9)7-20-22(11)13-4-2-3-12(21-13)15(17,18)19/h2-7H,1H3 |
| InChIKey | OHPWGRUIJNVVIC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |