About 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole
7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole (PubChem CID 118665515) has the molecular formula C11H10N4
and a molecular weight of 198.23 g/mol. Its IUPAC name is 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole |
| PubChem CID | 118665515 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole |
| SMILES | C=CCc1ccc2c(c1)Cn1nnnc1-2 |
| InChI | InChI=1S/C11H10N4/c1-2-3-8-4-5-10-9(6-8)7-15-11(10)12-13-14-15/h2,4-6H,1,3,7H2 |
| InChIKey | IOGSTNGITWYPJB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole?
The IUPAC name of 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole (CID 118665515) is 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole.
What is the SMILES notation for 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole?
The canonical SMILES for 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole is C=CCc1ccc2c(c1)Cn1nnnc1-2.
What is the InChIKey of 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole?
The InChIKey is IOGSTNGITWYPJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4/c1-2-3-8-4-5-10-9(6-8)7-15-11(10)12-13-14-15/h2,4-6H,1,3,7H2.
What are the key properties of 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole?
7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole has a molecular weight of 198.23 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-prop-2-enyl-5H-tetrazolo[5,1-a]isoindole is sourced from PubChem (CID 118665515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).