C23H21N3 — CID 118665751
6-cyclopropyl-1-methyl-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinoline (PubChem CID 118665751) has the molecular formula C23H21N3 and a molecular weight of 339.44 g/mol. Its IUPAC name is 6-cyclopropyl-1-methyl-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinoline.
| Compound Name | 6-cyclopropyl-1-methyl-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinoline |
|---|---|
| PubChem CID | 118665751 |
| Molecular Formula | C23H21N3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 6-cyclopropyl-1-methyl-4-[4-(1-methylpyrazol-4-yl)phenyl]isoquinoline |
| SMILES | Cc1ncc(-c2ccc(-c3cnn(C)c3)cc2)c2cc(C3CC3)ccc12 |
| InChI | InChI=1S/C23H21N3/c1-15-21-10-9-19(16-3-4-16)11-22(21)23(13-24-15)18-7-5-17(6-8-18)20-12-25-26(2)14-20/h5-14,16H,3-4H2,1-2H3 |
| InChIKey | FJBKLWBFAXQUFS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |