C19H25N5OS — CID 69052567
2-[[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]amino]ethanol (PubChem CID 69052567) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]amino]ethanol.
| Compound Name | 2-[[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]amino]ethanol |
|---|---|
| PubChem CID | 69052567 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-[[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]amino]ethanol |
| SMILES | Cn1cc(-c2cn(S)c3ncc(C4CCC(NCCO)CC4)cc23)cn1 |
| InChI | InChI=1S/C19H25N5OS/c1-23-11-15(10-22-23)18-12-24(26)19-17(18)8-14(9-21-19)13-2-4-16(5-3-13)20-6-7-25/h8-13,16,20,25-26H,2-7H2,1H3 |
| InChIKey | LERMPJGHQWTRBW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|