C21H25N5OS — CID 69050553
4-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohex-3-en-1-yl]morpholine (PubChem CID 69050553) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohex-3-en-1-yl]morpholine.
| Compound Name | 4-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohex-3-en-1-yl]morpholine |
|---|---|
| PubChem CID | 69050553 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohex-3-en-1-yl]morpholine |
| SMILES | Cn1cc(-c2cn(S)c3ncc(C4=CCC(N5CCOCC5)CC4)cc23)cn1 |
| InChI | InChI=1S/C21H25N5OS/c1-24-13-17(12-23-24)20-14-26(28)21-19(20)10-16(11-22-21)15-2-4-18(5-3-15)25-6-8-27-9-7-25/h2,10-14,18,28H,3-9H2,1H3 |
| InChIKey | USHOCIJXFJAGGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|