C15H18N4S — CID 70922298
5-(2-methylpropyl)-3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridine (PubChem CID 70922298) has the molecular formula C15H18N4S and a molecular weight of 286.40 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridine.
| Compound Name | 5-(2-methylpropyl)-3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70922298 |
| Molecular Formula | C15H18N4S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-(2-methylpropyl)-3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridine |
| SMILES | CC(C)Cc1cnc2c(c1)c(-c1cnn(C)c1)cn2S |
| InChI | InChI=1S/C15H18N4S/c1-10(2)4-11-5-13-14(12-7-17-18(3)8-12)9-19(20)15(13)16-6-11/h5-10,20H,4H2,1-3H3 |
| InChIKey | BYJZJKZLQBHWHN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|