C29H21BrN4S — CID 70930308
5-bromo-1-sulfanyl-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine (PubChem CID 70930308) has the molecular formula C29H21BrN4S and a molecular weight of 537.49 g/mol. Its IUPAC name is 5-bromo-1-sulfanyl-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-1-sulfanyl-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 70930308 |
| Molecular Formula | C29H21BrN4S |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | 5-bromo-1-sulfanyl-3-(1-tritylpyrazol-4-yl)pyrrolo[2,3-b]pyridine |
| SMILES | Sn1cc(-c2cnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)c2cc(Br)cnc21 |
| InChI | InChI=1S/C29H21BrN4S/c30-25-16-26-27(20-33(35)28(26)31-18-25)21-17-32-34(19-21)29(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-20,35H |
| InChIKey | LFEBMGFDJTWVFI-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|