C19H15BrClN3S — CID 129162974
5-bromo-3-[1-[(3-chlorophenyl)methyl]-2H-pyridin-4-yl]-1-sulfanylpyrrolo[2,3-b]pyridine (PubChem CID 129162974) has the molecular formula C19H15BrClN3S and a molecular weight of 432.77 g/mol. Its IUPAC name is 5-bromo-3-[1-[(3-chlorophenyl)methyl]-2H-pyridin-4-yl]-1-sulfanylpyrrolo[2,3-b]pyridine.
| Compound Name | 5-bromo-3-[1-[(3-chlorophenyl)methyl]-2H-pyridin-4-yl]-1-sulfanylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 129162974 |
| Molecular Formula | C19H15BrClN3S |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 5-bromo-3-[1-[(3-chlorophenyl)methyl]-2H-pyridin-4-yl]-1-sulfanylpyrrolo[2,3-b]pyridine |
| SMILES | Sn1cc(C2=CCN(Cc3cccc(Cl)c3)C=C2)c2cc(Br)cnc21 |
| InChI | InChI=1S/C19H15BrClN3S/c20-15-9-17-18(12-24(25)19(17)22-10-15)14-4-6-23(7-5-14)11-13-2-1-3-16(21)8-13/h1-6,8-10,12,25H,7,11H2 |
| InChIKey | JNSOGHCCTGHKEY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 21.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|