C22H29N5OS — CID 69051293
N-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]oxan-4-amine (PubChem CID 69051293) has the molecular formula C22H29N5OS and a molecular weight of 411.58 g/mol. Its IUPAC name is N-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]oxan-4-amine.
| Compound Name | N-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]oxan-4-amine |
|---|---|
| PubChem CID | 69051293 |
| Molecular Formula | C22H29N5OS |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-[4-[3-(1-methylpyrazol-4-yl)-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl]cyclohexyl]oxan-4-amine |
| SMILES | Cn1cc(-c2cn(S)c3ncc(C4CCC(NC5CCOCC5)CC4)cc23)cn1 |
| InChI | InChI=1S/C22H29N5OS/c1-26-13-17(12-24-26)21-14-27(29)22-20(21)10-16(11-23-22)15-2-4-18(5-3-15)25-19-6-8-28-9-7-19/h10-15,18-19,25,29H,2-9H2,1H3 |
| InChIKey | PMYFZDXNQHCQPU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|