C10H11F2N3O3 — CID 118667819
methyl (E)-4-[[2-(difluoromethyl)pyrazole-3-carbonyl]amino]but-2-enoate (PubChem CID 118667819) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is methyl (E)-4-[[2-(difluoromethyl)pyrazole-3-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[2-(difluoromethyl)pyrazole-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 118667819 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl (E)-4-[[2-(difluoromethyl)pyrazole-3-carbonyl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)c1ccnn1C(F)F |
| InChI | InChI=1S/C10H11F2N3O3/c1-18-8(16)3-2-5-13-9(17)7-4-6-14-15(7)10(11)12/h2-4,6,10H,5H2,1H3,(H,13,17)/b3-2+ |
| InChIKey | HQUQHHSYSZFPNG-NSCUHMNNSA-N |
| XLogP | 0.74 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|