C12H20F2N4O — CID 19584425
N-[3-(diethylamino)propyl]-1-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 19584425) has the molecular formula C12H20F2N4O and a molecular weight of 274.31 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19584425 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C12H20F2N4O/c1-3-17(4-2)8-5-7-15-11(19)10-6-9-18(16-10)12(13)14/h6,9,12H,3-5,7-8H2,1-2H3,(H,15,19) |
| InChIKey | KANQZRDWYASVBT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|