C13H24O2 — CID 118670944
2,2,3,3,4-pentamethyl-5-methylideneheptanoic acid (PubChem CID 118670944) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2,2,3,3,4-pentamethyl-5-methylideneheptanoic acid.
| Compound Name | 2,2,3,3,4-pentamethyl-5-methylideneheptanoic acid |
|---|---|
| PubChem CID | 118670944 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2,2,3,3,4-pentamethyl-5-methylideneheptanoic acid |
| SMILES | C=C(CC)C(C)C(C)(C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H24O2/c1-8-9(2)10(3)12(4,5)13(6,7)11(14)15/h10H,2,8H2,1,3-7H3,(H,14,15) |
| InChIKey | RXBMPQUCVUSQDV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|