C26H31N3O5 — CID 118671382
(2S)-2-[1-[4-[2-[4-(1,2-dihydroxy-2-methylpropyl)phenyl]ethynyl]phenyl]ethenyl-methylamino]-N-hydroxy-N',2-dimethylpropanediamide (PubChem CID 118671382) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is (2S)-2-[1-[4-[2-[4-(1,2-dihydroxy-2-methylpropyl)phenyl]ethynyl]phenyl]ethenyl-methylamino]-N-hydroxy-N',2-dimethylpropanediamide.
| Compound Name | (2S)-2-[1-[4-[2-[4-(1,2-dihydroxy-2-methylpropyl)phenyl]ethynyl]phenyl]ethenyl-methylamino]-N-hydroxy-N',2-dimethylpropanediamide |
|---|---|
| PubChem CID | 118671382 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (2S)-2-[1-[4-[2-[4-(1,2-dihydroxy-2-methylpropyl)phenyl]ethynyl]phenyl]ethenyl-methylamino]-N-hydroxy-N',2-dimethylpropanediamide |
| SMILES | C=C(c1ccc(C#Cc2ccc(C(O)C(C)(C)O)cc2)cc1)N(C)[C@@](C)(C(=O)NC)C(=O)NO |
| InChI | InChI=1S/C26H31N3O5/c1-17(29(6)26(4,23(31)27-5)24(32)28-34)20-13-9-18(10-14-20)7-8-19-11-15-21(16-12-19)22(30)25(2,3)33/h9-16,22,30,33-34H,1H2,2-6H3,(H,27,31)(H,28,32)/t22?,26-/m0/s1 |
| InChIKey | COTCCRACNFUYFP-XGCAABAXSA-N |
| XLogP | 1.80 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|