C23H26N3O9P — CID 146408797
[[2-[[4-[2-[4-[(1S)-1,2-dihydroxyethyl]phenyl]ethynyl]benzoyl]-methylamino]-2-methyl-3-(methylamino)-3-oxopropanoyl]amino] dihydrogen phosphate (PubChem CID 146408797) has the molecular formula C23H26N3O9P and a molecular weight of 519.45 g/mol. Its IUPAC name is [[2-[[4-[2-[4-[(1S)-1,2-dihydroxyethyl]phenyl]ethynyl]benzoyl]-methylamino]-2-methyl-3-(methylamino)-3-oxopropanoyl]amino] dihydrogen phosphate.
| Compound Name | [[2-[[4-[2-[4-[(1S)-1,2-dihydroxyethyl]phenyl]ethynyl]benzoyl]-methylamino]-2-methyl-3-(methylamino)-3-oxopropanoyl]amino] dihydrogen phosphate |
|---|---|
| PubChem CID | 146408797 |
| Molecular Formula | C23H26N3O9P |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [[2-[[4-[2-[4-[(1S)-1,2-dihydroxyethyl]phenyl]ethynyl]benzoyl]-methylamino]-2-methyl-3-(methylamino)-3-oxopropanoyl]amino] dihydrogen phosphate |
| SMILES | CNC(=O)C(C)(C(=O)NOP(=O)(O)O)N(C)C(=O)c1ccc(C#Cc2ccc([C@H](O)CO)cc2)cc1 |
| InChI | InChI=1S/C23H26N3O9P/c1-23(21(30)24-2,22(31)25-35-36(32,33)34)26(3)20(29)18-12-8-16(9-13-18)5-4-15-6-10-17(11-7-15)19(28)14-27/h6-13,19,27-28H,14H2,1-3H3,(H,24,30)(H,25,31)(H2,32,33,34)/t19-,23?/m1/s1 |
| InChIKey | YSCFRCXFOYYHBK-HWYAHNCWSA-N |
| XLogP | -0.17 |
| TPSA | 185.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|